HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,6-Dichlor-N-4-hydroxyphenyl-p-benzochinonmonoimin
DCPIP · 2,6-dichloroindophenol · Dichloroindophenol · DPIP/DCIP · Indochlorophenol · Dichlorophenolindphenol · ，6-DICHLOROPHENOLINDOPHENOL · 2,6-Dichlorophenolindophenol
Identifikatoren & physikalische Daten
| CAS No. | 537-14-4 |
|---|---|
| Summenformel | C12H7Cl2NO2 |
| Durchschnittliche Molmasse | 268,09 g/mol |
| Monoisotopische Masse | 266,98538382 g/mol |
| SMILES | O=C1C=CC(=Nc2cc(Cl)c(O)c(Cl)c2)C=C1 |
| InChIKey | FBWADIKARMIWNM-UHFFFAOYSA-N |
| PubChem CID | 13726 |
| ChEMBL | CHEMBL198157 |
| ChEBI | CHEBI:945 |
| DTXSID | DTXSID501174455 |
| Lokaler Name | 2,6-Dichlor-N-4-hydroxyphenyl-p-benzochinonmonoimin |
Chemische & physikalische Eigenschaften
| XLogP | 2,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 49,7 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 17 |
| Formalladung | 0 |
| Komplexität | 373 |
| Siedepunkt | 393.5±42.0 °C(Predicted) |
| Dichte | 1.43±0.1 g/cm3(Predicted) |
| Lagerbedingungen | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| Löslichkeit | DMSO (Slightly), Methanol (Slightly) |
| pKa (Säurekonstante) | 10.49±0.30(Predicted) |
| Aggregatzustand | Solid |
| Farbe | Dark Blue to Very Dark Blue |
| Stabilität | Hygroscopic |
| InChI | InChI=1S/C12H7Cl2NO2/c13-10-5-8(6-11(14)12(10)17)15-7-1-3-9(16)4-2-7/h1-6,16H |
| InChIKey | CCBICDLNWJRFPO-UHFFFAOYSA-N |
| SMILES | C1(=O)C(Cl)=C/C(=N\C2=CC=C(O)C=C2)/C=C1Cl |
| EPA chemische Informationen | 2,6-Dichloroindophenol (956-48-9) |
Sicherheit & Vorschriften
| TSCA-Inventar-Status | TSCA listed |
|---|
Anwendungen & Verwendung
Verwenden
2,6-Dichlorophenolindophenol (Technical Grade) is an organic redox dye, and is commonly used to assess ascorbic acid content.