HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Demoxepam
Chlordiazepoxide Related CoMpound A · ro5-2092 · NSC 4607 · Ro 5-2092 · NSC-46077 · NSC-46007 · Demoxepam · NSC 169898
Identifikatoren & physikalische Daten
| CAS No. | 963-39-3 |
|---|---|
| Summenformel | C15H11ClN2O2 |
| Durchschnittliche Molmasse | 286,71 g/mol |
| SMILES | O=C1CN(O)C(c2ccccc2)=c2cc(Cl)ccc2=N1 |
| InChIKey | PSADRZMLSXCSAS-UHFFFAOYSA-N |
| PubChem CID | 13756 |
| ChEMBL | CHEMBL1597677 |
| DTXSID | DTXSID4046155 |
| Lokaler Name | Demoxepam |
Chemische & physikalische Eigenschaften
| XLogP | 2,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 52,9 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 20 |
| Formalladung | 0 |
| Komplexität | 554 |
| Arzneimittel | Pharmaceuticals -> Synthetic Cannabinoids or Psychoactive Compounds |
| LogP (Verteilungskoeffizient) | 1.49 |
| Löslichkeit | 37.9 [ug/mL] (The mean of the results at pH 7.4)Chloroform (Slightly), Methanol (Slightly) |
| Human Drugs | Pharmaceuticals |
| Collision Cross Section | 161.7 Ų [M+H]+ [CCS Type: TWMethod: Major Mix IMS/Tof Calibration Kit (Waters)] |
| Schmelzpunkt | 235-236 °C (decomp) |
| Dichte | 1.40±0.1 g/cm3(Predicted) |
| Flammpunkt | 2℃ |
| Lagerbedingungen | -20°C |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | pKa 4.5 (Uncertain) |
| Farbe | White to Pale Yellow |
| Hauptanwendungen | pharmaceutical (small molecule) |
| InChI | 1S/C15H11ClN2O2/c16-11-6-7-13-12(8-11)15(10-4-2-1-3-5-10)18(20)9-14(19)17-13/h1-8,20H,9H2 |
| InChIKey | PSADRZMLSXCSAS-UHFFFAOYSA-N |
| SMILES | ClC1=CC2=C(N(CC(=O)N=C2C=C1)O)c3ccccc3 |
| NIST chemische Informationen | Demoxepam(963-39-3) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| UN-Transportnummer | UN 1648 3 / PGII |
| Zollcode | 2933996100 |
| R-Sätze (R) | 11-20/21/22-36 |
| Gefahrensymbole | F,Xn |
| Sicherheitshinweise (S) | 16-26-36/37 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Acute Tox. 4 Oral |
Anwendungen & Verwendung
Verwenden
A major metabolite of Chlordiazepoxide (C327050). A benzodiapine derivative with anticonvulsant properties.