HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(1-Methylcyclopropyl)methanol
(1-Methylcyclopropyl)methanol · 1-METHYLCYCLOPROPANEMETHANOL · Cyclopropanemethanol,1-methyl- · 1-MethylcyclopropaneMethanol 98% · 1-Methylcyclopropanemethanol ISO 9001：2015 REACH · (1-Methylcyclopropyl)Methanol 2-chloro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride
Identifikatoren & physikalische Daten
| CAS No. | 2746-14-7 |
|---|---|
| Summenformel | C5H10O |
| Durchschnittliche Molmasse | 86,13 g/mol |
| Monoisotopische Masse | 86,07316494 g/mol |
| SMILES | CC1(CO)CC1 |
| InChIKey | PIZQWRXTMGASCZ-UHFFFAOYSA-N |
| PubChem CID | 137701 |
| EC No. | 626-559-6 |
| DTXSID | DTXSID90181877 |
Chemische & physikalische Eigenschaften
| XLogP | 0,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 20,2 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 6 |
| Formalladung | 0 |
| Komplexität | 55 |
| Schmelzpunkt | -15.1°C |
| Siedepunkt | 128 °C/750 mmHg (lit.) |
| Dichte | 0.887 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.431(lit.) |
| Flammpunkt | 93 °F |
| Lagerbedingungen | Storage temp. 2-8°C |
| pKa (Säurekonstante) | 15.10±0.10(Predicted) |
| InChI | InChI=1S/C5H10O/c1-5(4-6)2-3-5/h6H,2-4H2,1H3 |
| InChIKey | PIZQWRXTMGASCZ-UHFFFAOYSA-N |
| SMILES | C1(C)(CO)CC1 |
| LogP (Verteilungskoeffizient) | 0.720 (est) |
| NIST chemische Informationen | 1-Methylcyclopropanemethanol(2746-14-7) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P280, P303+P361+P353, P370+P378, P403+P235, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 2 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 1987 3/PG 3 |
| R-Sätze (R) | 10 |
| Sicherheitshinweise (S) | 16-29-33 |
| Gefahrenklasse | 3.2Flam. Liq. 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
1-Methylcyclopropanemethanol has been used in the preparation of (±)-2-(benzyloxycarbonylamino)-2-(1′-methylcyclopropyl)ethanamide.