HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 137952257Erstellt: 1. November 2026
3-(4-((2-Methylpiperidin-1-yl)sulfonyl)phenyl)propan-1-amine hydrochloride
https://huagongshe.com/de/chemical/137952257
Identifikatoren & physikalische Daten
| CAS No. | 2219374-18-0 |
|---|
| Summenformel | C15H25ClN2O2S |
|---|
| Durchschnittliche Molmasse | 332,9 g/mol |
|---|
| Monoisotopische Masse | 332,1325269 g/mol |
|---|
| SMILES | CC1CCCCN1S(=O)(=O)c1ccc(CCCN)cc1.Cl |
|---|
| InChIKey | GDUNGFQZPIHEMG-UHFFFAOYSA-N |
|---|
| PubChem CID | 137952257 |
|---|
| EC No. | 977-547-5 |
|---|
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 71,8 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 5 |
|---|
| Schwere Atome | 21 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 383 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
