HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Methyl-4-bromcrotonat
(E)-Methyl 4-broMobut-2-enoate · 4-bromocrotonate · Methyl 4-bromobut-2-enoate · Methyl bromocrotonate · Bromo Methyl Crotonate · Methyl Trans-4-Bromocrotonate · methylbromocrotonate · Remazolam impurity 2
Identifikatoren & physikalische Daten
| CAS No. | 1117-71-1 |
|---|---|
| Summenformel | C5H7BrO2 |
| Durchschnittliche Molmasse | 179,01 g/mol |
| Monoisotopische Masse | 177,96294156 g/mol |
| SMILES | COC(=O)C=CCBr |
| InChIKey | RWIKCBHOVNDESJ-UHFFFAOYSA-N |
| PubChem CID | 14229 |
| DTXSID | DTXSID8061503 |
| Lokaler Name | Methyl-4-bromcrotonat |
Chemische & physikalische Eigenschaften
| XLogP | 1,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 26,3 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 8 |
| Formalladung | 0 |
| Komplexität | 98,6 |
| Siedepunkt | 83-85 °C13 mm Hg(lit.) |
| Dichte | 1.522 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.501 |
| Flammpunkt | 197 °F |
| Lagerbedingungen | 2-8°C |
| Aggregatzustand | Liquid |
| Wichte | 1.52 |
| Farbe | Clear yellow |
| Löslichkeit | Slightly soluble in water. |
| BRN | 1745755 |
| InChI | InChI=1S/C5H7BrO2/c1-8-5(7)3-2-4-6/h2-3H,4H2,1H3/b3-2+ |
| InChIKey | RWIKCBHOVNDESJ-NSCUHMNNSA-N |
| SMILES | C(=O)(OC)/C=C/CBr |
| CAS Datenbank | 1117-71-1(CAS DataBase Reference) |
| NIST chemische Informationen | 2-Butenoic acid, 4-bromo-, methyl ester(1117-71-1) |
| EPA chemische Informationen | 2-Butenoic acid, 4-bromo-, methyl ester (1117-71-1) |
Sicherheit & Vorschriften
| F | 8-9 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | 3265 |
| Zollcode | 29161900 |
| RTECS-Nr. | GQ3120000 |
| R-Sätze (R) | 37/38-41-34-20/21/22 |
| Gefahrensymbole | Xi,C |
| hazard_note | Corrosive |
| Sicherheitshinweise (S) | 26-39-45-36/37/39 |
| Gefahrenklasse | 8Eye Dam. 1Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
It is a useful synthetic intermediate. It was used in the synthesis of irreversible inhibitors of EGFR and HER-2 tyrosine kinases with enhanced antitumor activities.
Herstellung & Synthese
synthetische
ethyl or methyl crotonate is treated with N-Bromosuccinimide/CCl4 and Dibenzoyl Peroxide.