HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
5-Chloro-2-(chloromethyl)pyridine
KML-32 · CML-029 · 5-Chloro-2-(chloromethyl) · 2-ChloroMethyl-5-chloropyridine · 5-Chloro-2-(chloromethyl)pyridine · 5-chloro-pyridin-2-ylmethyl chloride · Pyridine, 5-chloro-2-(chloroMethyl)- · 5-Chloro-2-(Chloromethyl)pyridine (HCl)
Identifikatoren & physikalische Daten
| CAS No. | 10177-24-9 |
|---|---|
| Summenformel | C6H5Cl2N |
| Durchschnittliche Molmasse | 162,01 g/mol |
| Monoisotopische Masse | 160,97990452 g/mol |
| SMILES | ClCc1ccc(Cl)cn1 |
| InChIKey | JTTKXEIHKDSIRC-UHFFFAOYSA-N |
| PubChem CID | 14517151 |
| EC No. | 169-709-1 |
| DTXSID | DTXSID40561206 |
Chemische & physikalische Eigenschaften
| XLogP | 1,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 12,9 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 87,1 |
| Siedepunkt | 48 °C |
| Dichte | 1.324±0.06 g/cm3(Predicted) |
| Lagerbedingungen | under inert gas (nitrogen or Argon) at 2-8°C |
| pKa (Säurekonstante) | 1.43±0.22(Predicted) |
| Aggregatzustand | liquid |
| Farbe | Colourless to red |
| InChI | InChI=1S/C6H5Cl2N/c7-3-6-2-1-5(8)4-9-6/h1-2,4H,3H2 |
| InChIKey | JTTKXEIHKDSIRC-UHFFFAOYSA-N |
| SMILES | C1(CCl)=NC=C(Cl)C=C1 |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P261, P264, P270, P271, P280, P301+P317, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P319, P321, P330, P363, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Zollcode | 2933399990 |
| Gefahrenklasse | IRRITANT |
Anwendungen & Verwendung
Verwenden
As an intermediate, 5-chloro-2-(chloromethyl)pyridine is used in the production of dyes and pigments, contributing to the development of new colorants for various industries, including textiles, plastics, and printing inks.