HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3',4'-Dichlorcinnamsure
(E)-3-(3,4-Dichlorophenyl)acrylic acid · Nsc518800 · RARECHEM BK HC T316 · OTAVA-BB BB7020400357 · 3,4-Dichlorociamic acid · 3,4-DICHLOROCINNAMIC ACID · 3,4-Dichlorocinnnamic Acid · Cinnamic acid, 3,4-dichloro-
Identifikatoren & physikalische Daten
| CAS No. | 1202-39-7 |
|---|---|
| Summenformel | C9H6Cl2O2 |
| Durchschnittliche Molmasse | 217,05 g/mol |
| Monoisotopische Masse | 215,9744848 g/mol |
| SMILES | O=C(O)C=Cc1ccc(Cl)c(Cl)c1 |
| InChIKey | RRLUFPHCTSFKNR-UHFFFAOYSA-N |
| PubChem CID | 14548 |
| DTXSID | DTXSID101311887 |
| Lokaler Name | 3',4'-Dichlorcinnamsure |
Chemische & physikalische Eigenschaften
| XLogP | 3,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 37,3 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 216 |
| Schmelzpunkt | 218-220 °C (lit.) |
| Siedepunkt | 366.6±32.0 °C(Predicted) |
| Dichte | 1.457±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | ethanol: soluble25mg/mL, very slightly hazy, faintly yellow |
| pKa (Säurekonstante) | 4.18±0.10(Predicted) |
| Aggregatzustand | Powder or Crystalline Powder |
| Farbe | White to off-white |
| BRN | 1872129 |
| InChI | InChI=1S/C9H6Cl2O2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5H,(H,12,13) |
| InChIKey | RRLUFPHCTSFKNR-DUXPYHPUSA-N |
| SMILES | C(O)(=O)C=CC1=CC=C(Cl)C(Cl)=C1 |
| CAS Datenbank | 1202-39-7(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29163990 |
| RTECS-Nr. | UD3333900 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36-24/25 |
| Gefahrenklasse | IRRITANT |
| Lagerklasse | 13 - Non Combustible Solids |
Anwendungen & Verwendung
Verwenden
3,4-Dichlorocinnamic acid was used in the preparation of indolopiperidine CCR2B receptor antagonists possessing a conformationally restricted C-5 linker chain and a restricted piperidine ring.