HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
9-(5-S-Methyl-5-thiopentofuranosyl)-9H-purin-6-amine
MTA · Methylthioadenosine · 5'-S-Methyl-5'-thioadenosine · 5'-Methylthioadenosine · Adenylthiomethylpentose · (2R,3R,4S,5S)-2-(6-Amino-9H-purin-9-yl)-5-((methylthio)methyl)tetrahydrofuran-3,4-diol · MESADO · 5’-methylthioadenosine
Identifikatoren & physikalische Daten
| CAS No. | 2457-80-9 |
|---|---|
| Summenformel | C11H15N5O3S |
| Durchschnittliche Molmasse | 297,34 g/mol |
| Monoisotopische Masse | 297,08956053 g/mol |
| SMILES | CSCC1OC(n2cnc3c(N)ncnc32)C(O)C1O |
| InChIKey | WUUGFSXJNOTRMR-UHFFFAOYSA-N |
| PubChem CID | 149 |
| ChEBI | CHEBI:180963 |
| DTXSID | DTXSID70862955 |
Chemische & physikalische Eigenschaften
| XLogP | -0,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 145 |
| H-Brücken-Donoren | 3 |
| H-Brücken-Akzeptoren | 8 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 20 |
| Formalladung | 0 |
| Komplexität | 352 |
| Schmelzpunkt | 210-213 °C (dec.) |
| Siedepunkt | 642.7±65.0 °C(Predicted) |
| Dichte | 1.85±0.1 g/cm3(Predicted) |
| Lagerbedingungen | -20°C |
| Löslichkeit | DMF (Sparingly), DMSO (Slightly), Methanol (Slightly) |
| Aggregatzustand | White solid |
| pKa (Säurekonstante) | 13.10±0.70(Predicted) |
| Farbe | White to Off-White |
| Biologische Quelle | synthetic (organic) |
| BRN | 42420 |
| Kosmetik-Inhaltsstoffe Funktionen | SKIN CONDITIONING |
| InChI | InChI=1S/C11H15N5O3S/c1-20-2-5-7(17)8(18)11(19-5)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H2,12,13,14)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | WUUGFSXJNOTRMR-IOSLPCCCSA-N |
| SMILES | S(C)C[C@H]1O[C@@H](N2C3C(=C(N=CN=3)N)N=C2)[C@H](O)[C@@H]1O |
Sicherheit & Vorschriften
| F | 10-21 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| RTECS-Nr. | AU7410000 |
| Sicherheitshinweise (S) | 22-24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
5′-Deoxy-5′-(methylthio)adenosine has been used as a protein methylation inhibitor to reduce E2F transcription factor 1 (E2F1) protein abundance in hepatocellular carcinoma (HCC) cells. It has also been used to inhibit histone methylation modification and study its role in hypoxia inducible factor-1 (Hif-1) nuclear transport.