HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Pyridin-2-carboxamid
PICOLINAMIDE · 2-PICOLINAMIDE · Picolinoylamide · PicolinaMide 98% · Picolinamide ,98% · 2-Picolinamide>alpha-Picolinamide · TIMTEC-BB SBB008128 · 2-Carbamoylpyridine
Identifikatoren & physikalische Daten
| CAS No. | 1452-77-3 |
|---|---|
| Summenformel | C6H6N2O |
| Durchschnittliche Molmasse | 122,12 g/mol |
| Monoisotopische Masse | 122,04801281 g/mol |
| SMILES | NC(=O)c1ccccn1 |
| InChIKey | IBBMAWULFFBRKK-UHFFFAOYSA-N |
| PubChem CID | 15070 |
| ChEBI | CHEBI:8200 |
| EC No. | 215-921-5 |
| DTXSID | DTXSID4061703 |
| Lokaler Name | Pyridin-2-carboxamid |
Chemische & physikalische Eigenschaften
| XLogP | 0,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 56 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 114 |
| SpringerMaterials Properties | Boiling point |
| LogP (Verteilungskoeffizient) | 0.15 |
| Schmelzpunkt | 110 °C (dec.)(lit.) |
| Siedepunkt | 143 °C / 20mmHg |
| Dichte | 1.2236 (rough estimate) |
| Brechungsindex | 1.5350 (estimate) |
| Lagerbedingungen | Inert atmosphere,Room Temperature |
| Löslichkeit | DMSO (Slightly), Methanol (Slightly) |
| pKa (Säurekonstante) | pK1: 2.10(+1) (20°C) |
| Aggregatzustand | Solid |
| Farbe | White to Off-White |
| BRN | 109617 |
| Kosmetik-Inhaltsstoffe Funktionen | SKIN CONDITIONING - EMOLLIENT |
| InChI | InChI=1S/C6H6N2O/c7-6(9)5-3-1-2-4-8-5/h1-4H,(H2,7,9) |
| InChIKey | IBBMAWULFFBRKK-UHFFFAOYSA-N |
| SMILES | C1(C(N)=O)=NC=CC=C1 |
| CAS Datenbank | 1452-77-3(CAS DataBase Reference) |
| EPA chemische Informationen | 2-Pyridinecarboxamide (1452-77-3) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 72 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29333990 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-37/39 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
Anwendungen & Verwendung
Verwenden
A nicotinic acid derivative for prevention and treatment of cancer by activating RUNX3 gene.