HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-Iodbiphenyl
4-Iodo-1,1'-biphenyl · 4-Phenyliodobenzene · 4-Iodbiphenyl · 4-Iodobipheny · 4- Iodophenyl · 4-IODOBIPHENYL · P-IODODIPHENYL · MONOIODOBIPHENYL
Identifikatoren & physikalische Daten
| CAS No. | 1591-31-7 |
|---|---|
| Summenformel | C12H9I |
| Durchschnittliche Molmasse | 280,1 g/mol |
| Monoisotopische Masse | 279,97489829 g/mol |
| SMILES | Ic1ccc(-c2ccccc2)cc1 |
| InChIKey | NXYICUMSYKIABQ-UHFFFAOYSA-N |
| PubChem CID | 15322 |
| EC No. | 216-469-1 |
| DTXSID | DTXSID7061807 |
| Lokaler Name | 4-Iodbiphenyl |
Chemische & physikalische Eigenschaften
| XLogP | 4,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 141 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Schmelzpunkt | 110-114 °C |
| Siedepunkt | 320°C(lit.) |
| Dichte | 1.6696 (rough estimate) |
| Brechungsindex | 1.7600 (estimate) |
| Lagerbedingungen | Keep in dark place,Sealed in dry,Room Temperature |
| Aggregatzustand | Crystalline Powder |
| Farbe | Off-white |
| Löslichkeit | Slightly soluble in water. |
| InChI | InChI=1S/C12H9I/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H |
| InChIKey | NXYICUMSYKIABQ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C(I)C=C1 |
| CAS Datenbank | 1591-31-7(CAS DataBase Reference) |
| NIST chemische Informationen | 1,1'-Biphenyl, 4-iodo-(1591-31-7) |
| EPA chemische Informationen | 1,1'-Biphenyl, 4-iodo- (1591-31-7) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (89.1%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P273, P280, P301+P317, P305+P354+P338, P317, P330, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (89.1%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 3077 9/PG 3 |
| Zollcode | 29039990 |
| R-Sätze (R) | 22-41-50/53-36/37/38 |
| Gefahrensymbole | Xn,N,Xi |
| Sicherheitshinweise (S) | 26-39-60-61-37/39 |
| Gefahrenklasse | 9Acute Tox. 4 OralAquatic Acute 1Aquatic Chronic 1Eye Dam. 1 |
| Verpackungsgruppe | III |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Beschreibung
Das 4-Ioddiphenyl bildet farblose, wasserunlösliche Kristalle. Der Stoff hat nur wissenschaftliches Interesse.
Verwenden
4-Iodobiphenyl is used as a starting material for the preparation of p-terphenyl derivatives. It is also used in Suzuki reaction.