HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Glycidyl tosylate, (R)-
(R)-GLYCIDYL TOSYLATE · Oxiran-2-ylmethyl 4-methylbenzenesulfonate · (2R)-(−2,2'-IMINOSTILBENE · RARECHEM AK HZ 0050 · )-Glycidyl tosylate · (R)-Glycidil Tosylate · LABOTEST-BB LT00440878 · pre-miR-372 inhibitor 3
Identifikatoren & physikalische Daten
| CAS No. | 113826-06-5 |
|---|---|
| Summenformel | C10H12O4S |
| Durchschnittliche Molmasse | 228,27 g/mol |
| Monoisotopische Masse | 228,04562986 g/mol |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2CO2)cc1 |
| InChIKey | NOQXXYIGRPAZJC-SECBINFHSA-N |
| PubChem CID | 154187 |
| EC No. | 601-283-9 |
| DTXSID | DTXSID00150574 |
Chemische & physikalische Eigenschaften
| XLogP | 1,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 64,3 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 298 |
| Schmelzpunkt | 46-49 °C(lit.) |
| Siedepunkt | 340.07°C (rough estimate) |
| Dichte | 1.3749 (rough estimate) |
| Brechungsindex | 1.5400 (estimate) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | dioxane: 50 mg/mL, cleardecomposes |
| Aggregatzustand | powder |
| Farbe | yellow to orange |
| BRN | 3592142 |
| InChI | InChI=1/C10H12O4S/c1-8-2-4-10(5-3-8)15(11,12)14-7-9-6-13-9/h2-5,9H,6-7H2,1H3/t9-/s3 |
| InChIKey | NOQXXYIGRPAZJC-DJEYLCQNNA-N |
| SMILES | C1(=CC=C(C)C=C1)S(=O)(=O)OC[C@@H]1OC1 |&1:12,r| |
| CAS Datenbank | 113826-06-5(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH318 (97.6%): Causes serious eye damage [Danger Serious eye damage/eye irritation]P203, P233, P260, P264+P265, P271, P280, P284, P304+P340, P305+P354+P338, P317, P318, P342+P316, P403, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Eye Dam. 1 (97.6%) |
| F | 3-10-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 3077 9/PG 3 |
| Zollcode | 29109000 |
| RTECS-Nr. | RR0510000 |
| R-Sätze (R) | 45-41-43-51/53-68 |
| Gefahrensymbole | Xn,N,T |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 61-45-36/37/39-26-53 |
| Gefahrenklasse | 9Aquatic Chronic 2Carc. 1BEye Dam. 1Muta. 2Skin Sens. 1 |
| Lagerklasse | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
Anwendungen & Verwendung
Verwenden
Protected Glycidol, (2R)-(-)-Glycidyl tosylate is used as an intermediate in the preparation of neurochemicals.