Identifikatoren & physikalische Daten
| CAS No. | 55066-76-7 |
|---|
| Summenformel | C12H4Br6 |
|---|
| Durchschnittliche Molmasse | 627,6 g/mol |
|---|
| Monoisotopische Masse | 621,54133 g/mol |
|---|
| SMILES | Brc1cc(Br)c(Br)c(-c2cc(Br)cc(Br)c2Br)c1 |
|---|
| InChIKey | OIQABQOZOVLYRA-UHFFFAOYSA-N |
|---|
| PubChem CID | 154367 |
|---|
| DTXSID | DTXSID10203601 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 7,7 |
|---|
| Polarare Oberfläche (TPSA) | 0 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 0 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 18 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 258 |
|---|
Sicherheit & Vorschriften
| Minimum Risk Level | Acute Oral: 0.01 mg/kg/day (L134) |
|---|
| Treatment | EYES: irrigate opened eyes for several minutes under running water.
INGESTION: do not induce vomiting. Rinse mouth with water (never give anything by mouth to an unconscious person). Seek immediate medical advice.
SKIN: should be treated immediately by rinsing the affected parts in cold running water for at least 15 minutes, followed by thorough washing with soap and water. If necessary, the person should shower and change contaminated clothing and shoes, and then must seek medical attention.
INHALATION: supply fresh air. If required provide artificial respiration. |
|---|
| Gesundheitliche Auswirkungen | PBB exposure may cause weight loss, skin disorders (such as acne), nervous and immune systems effects, and effects on the liver, kidneys, and thyroid gland. (L628) |
|---|
| Expositionspfade | Oral (L628)inhalation (L628)dermal (L628) |
|---|
| Toxizitätsübersicht | The exact mechanism of toxicty of PBBs varies depending on the specific congener. The predominant interaction is believed to involve the aryl hydrocarbon receptor (AhR). PBBs bind to and activate the AhR, which in turn initiates the transcriptional upregulation of a number of genes, affecting biochemical and endocrine pathways, cell cycle regulation, morphogenesis, oxidative stress response, and various other processes. This results in the numerous toxic responses characteristic of PBBs. Some of the known induced genes include the cytochrome P-450-dependent monooxygenases CYP1A1 and CYP1A2. (L628) |
|---|
| Signs and Symptoms | Symptoms of PBB exposure may include nausea, abdominal pain, loss of appetite, joint pain, fatigue, and weakness. (L629) |
|---|
| Carcinogen Classification | 2A, probably carcinogenic to humans. (L135) |
|---|
