HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1-Phenylpropan-1,2-diol
1,2-Propanediol, 1-phenyl- · Phenylpropanediol · Felbamate Impurity 10 · 1-phenyl-1,2-propandiol · 1-phenylpropane-1,2-diol · 1,2-Dihydroxy-1-phenylpropane
Identifikatoren & physikalische Daten
| CAS No. | 1855-09-0 |
|---|---|
| Summenformel | C9H12O2 |
| Durchschnittliche Molmasse | 152,19 g/mol |
| Monoisotopische Masse | 152,08372962 g/mol |
| SMILES | CC(O)C(O)c1ccccc1 |
| InChIKey | MZQZXSHFWDHNOW-UHFFFAOYSA-N |
| PubChem CID | 15825 |
| ChEBI | CHEBI:224860 |
| EC No. | 217-452-1 |
| DTXSID | DTXSID10883760 |
| Lokaler Name | 1-Phenylpropan-1,2-diol |
Chemische & physikalische Eigenschaften
| XLogP | 1,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 40,5 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 108 |
| Kovats Retention Index | 236123651326.6 |
| Schmelzpunkt | 56-57 °C |
| Siedepunkt | 140-145 °C(Press: 30 Torr) |
| Dichte | 1.1003 g/cm3 |
| Löslichkeit | Chloroform (Slightly), Methanol (Slightly) |
| Aggregatzustand | Low-Melting Solid |
| pKa (Säurekonstante) | 14.09±0.20(Predicted) |
| Farbe | White to Off-White |
| Stabilität | Hygroscopic |
| InChI | InChI=1S/C9H12O2/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9-11H,1H3 |
| InChIKey | MZQZXSHFWDHNOW-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1)(O)C(O)C |
| EPA chemische Informationen | 1,2-Propanediol, 1-phenyl- (1855-09-0) |
Sicherheit & Vorschriften
| TSCA-Inventar-Status | TSCA listed |
|---|---|
| Zollcode | 2906290000 |
Anwendungen & Verwendung
Verwenden
1-Phenyl-1,2-propanediol is a reagent in pharmaceutical chemistry, used in the synthesis of nor(pseudo)ephedrine related compounds.