HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Quizalofop-p-ethyl
Targa Dt · EXP-3864 · assureii · FBC-32197 · DPX-Y6202 · nci-861094 · Pilot Super · Targa Saper
Identifikatoren & physikalische Daten
| CAS No. | 100646-51-3 |
|---|---|
| Summenformel | C19H17ClN2O4 |
| Durchschnittliche Molmasse | 372,8 g/mol |
| Monoisotopische Masse | 372,0876847 g/mol |
| SMILES | CCOC(=O)[C@@H](C)Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1 |
| InChIKey | OSUHJPCHFDQAIT-GFCCVEGCSA-N |
| PubChem CID | 1617113 |
| ChEMBL | CHEMBL3138620 |
| ChEBI | CHEBI:137938 |
| DTXSID | DTXSID0034857 |
Chemische & physikalische Eigenschaften
| XLogP | 4,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 70,5 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 7 |
| Schwere Atome | 26 |
| Formalladung | 0 |
| Komplexität | 459 |
| Pestizide | HerbicidesActive substance -> EU Pesticides database: ApprovedEnvironmental transformation -> Pesticides (parent, predecessor) |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Collision Cross Section | 191.3 Ų [M+H]+ [CCS Type: DTBuffer gas: N2Ionization: ESI+Dataset: TOXCASTSource Identifier: DTXSID0034857] |
| Schmelzpunkt | 76-77°C |
| Siedepunkt | 220 °C |
| Dichte | 1.301±0.06 g/cm3(Predicted) |
| Flammpunkt | >100 °C |
| Lagerbedingungen | Store at 2-8°C |
| Löslichkeit | Chloroform (Slightly), Methanol (Slightly)0.04 g/100 mL |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | -1.39±0.48(Predicted) |
| Farbe | Light yellow to yellow |
| Henry-Konstante | 4.8×103 mol/(m3Pa) at 25℃, Ebert et al. (2023) |
| Hauptanwendungen | agricultureenvironmental |
| InChI | InChI=1S/C19H17ClN2O4/c1-3-24-19(23)12(2)25-14-5-7-15(8-6-14)26-18-11-21-17-10-13(20)4-9-16(17)22-18/h4-12H,3H2,1-2H3/t12-/m1/s1 |
| InChIKey | OSUHJPCHFDQAIT-GFCCVEGCSA-N |
| SMILES | C(OCC)(=O)[C@H](OC1=CC=C(OC2C=NC3C(N=2)=CC=C(Cl)C=3)C=C1)C |
| CAS Datenbank | 100646-51-3(CAS DataBase Reference) |
| EPA chemische Informationen | Quizalofop-P-ethyl (100646-51-3) |
Sicherheit & Vorschriften
| Regulatorische Informationen | 2009/37, Reg. (EU) 2017/555, Reg. (EU) 2018/155, Reg. (EU) 2021/1449, Reg. (EU) 2022/1480, Reg. (EU) 2023/1757, Reg. (EU) No 540/2011 |
|---|---|
| DOT Hazard Classification | Quizalofop-p-ethylSevere marine pollutant |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN3077 9/PG 3 |
| Zollcode | 29333990 |
| RTECS-Nr. | UA2458257 |
| R-Sätze (R) | 21/22 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 36/37 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Acute Tox. 4 OralAquatic Acute 1Aquatic Chronic 1 |
Anwendungen & Verwendung
Verwenden
Post-emergence herbicide for control of grassy weeds in broad-leaved crops. Herbicide.