HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Benzene-1,2-dicarboxylic acid--ethenyl acetate (1/1)
polyvinylacetate phthalate polymer · Polyvinyl acetate phthalateQ: What is Polyvinyl acetate phthalate Q: What is the CAS Number of Polyvinyl acetate phthalate
Identifikatoren & physikalische Daten
| CAS No. | 34481-48-6 |
|---|---|
| Summenformel | C12H12O6 |
| Durchschnittliche Molmasse | 252,222 g/mol |
| Monoisotopische Masse | 252,0633881 g/mol |
| SMILES | C=COC(C)=O.O=C(O)c1ccccc1C(=O)O |
| InChIKey | LUJQXGBDWAGQHS-UHFFFAOYSA-N |
| PubChem CID | 161821 |
| DTXSID | DTXSID40956012 |
Chemische & physikalische Eigenschaften
| Löslichkeit | Soluble in ethanol and methanolsparingly soluble in acetone and propan-2-olpractically insoluble in chloroform, dichloromethane, and water. In buffer solutions, polyvinyl acetate phthalate (200 mg/L) is insoluble below pH 5 and becomes soluble at pH values above 5. Polyvinyl acetate pththalate shows a sharp solubility response with pHthis occurs at pH 4.5–5.0, which is lower than for most other polymers used for enteric coatings. Solubility is also influenced by ionic strength. |
|---|---|
| InChI | InChI=1S/C8H6O4.C4H6O2/c9-7(10)5-3-1-2-4-6(5)8(11)121-3-6-4(2)5/h1-4H,(H,9,10)(H,11,12)3H,1H2,2H3 |
| InChIKey | LUJQXGBDWAGQHS-UHFFFAOYSA-N |
| SMILES | C(C1C=CC=CC=1C(=O)O)(=O)O.O(C=C)C(=O)C |