HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(2-(tert-Butoxy)-2-oxoethyl)triphenylphosphonium chloride
Carbo-tert-butoxymethyl triphenylphosphonium chloride · (tert-Butoxycarbonylmethyl)triphenylphosphonium chloride · (tert-Buloxycarbonylmethyl)triphenylphosphonium chloride · (2-(tert-Butoxy)-2-oxoethyl)triphenylphosphonium chloride · (TERT-BUTOXYCARBONYLMETHYL)TRIPHENYLPHOSPHONIUM CHLORIDE, 98 · [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-triphenylphosphanium:chloride
Identifikatoren & physikalische Daten
| CAS No. | 35000-37-4 |
|---|---|
| Summenformel | C24H26ClO2P |
| Durchschnittliche Molmasse | 412,9 g/mol |
| Monoisotopische Masse | 412,13589438 g/mol |
| SMILES | CC(C)(C)OC(=O)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
| InChIKey | PWEGQXPODNSKMU-UHFFFAOYSA-M |
| PubChem CID | 16211488 |
| EC No. | 609-051-9 |
| DTXSID | DTXSID70583436 |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 26,3 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 7 |
| Schwere Atome | 28 |
| Formalladung | 0 |
| Komplexität | 418 |
| Schmelzpunkt | 191-193°C |
| Dampfdruck | 0.001Pa at 20℃ |
| Aggregatzustand | solid |
| BRN | 4116684 |
| InChI | 1S/C24H26O2P.ClH/c1-24(2,3)26-23(25)19-27(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18H,19H2,1-3H31H/q+1/p-1 |
| InChIKey | PWEGQXPODNSKMU-UHFFFAOYSA-M |
| SMILES | [Cl-].CC(C)(C)OC(=O)C[P+](c1ccccc1)(c2ccccc2)c3ccccc3 |
| Oberflächenspannung | 70.5mN/m at 1g/L and 20.1℃ |
| CAS Datenbank | 35000-37-4(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (97.7%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | Status: Active Update: 08-12-2015 https://echa.europa.eu/registration-dossier/-/registered-dossier/16594 |
| Hazard Classes and Categories | Skin Irrit. 2 (97.7%) |
| F | 3-9 |
| Wassergefährdungsklasse (WGK) | 3 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
Anwendungen & Verwendung
Verwenden
Reactant for:Stereoselective preparation of (arylamino)quinazoline derivatives bearing tethered acrylamide moieties as inhibitors of epidermal growth factor receptor and histone deacetylaseThermal decomposition reactions