HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1,1'-Biphenyl, 4,4'-dimethoxy-
4,4'-BIANISOLE · 4,4'-Dimethoxybiphenyl · 4,4′-Dimethoxybiphenyl · 4,4'-DiMethoxylbiphenyl · 4,4'-Dimethyoxybiphenyl · 4,4''-Dimethoxybiphenyl · 4,4'-Dimethoxybiphenyl,98% · 4,4'-Dimethoxy-1,1'-biphenyl
Identifikatoren & physikalische Daten
| CAS No. | 2132-80-1 |
|---|---|
| Summenformel | C14H14O2 |
| Durchschnittliche Molmasse | 214,26 g/mol |
| Monoisotopische Masse | 214,09937969 g/mol |
| SMILES | COc1ccc(-c2ccc(OC)cc2)cc1 |
| InChIKey | UIMPAOAAAYDUKQ-UHFFFAOYSA-N |
| PubChem CID | 16484 |
| ChEMBL | CHEMBL1735271 |
| DTXSID | DTXSID30175593 |
Chemische & physikalische Eigenschaften
| XLogP | 4,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 18,5 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 16 |
| Formalladung | 0 |
| Komplexität | 167 |
| SpringerMaterials Properties | Chemical diffusion |
| Schmelzpunkt | 179-180 °C (subl.)(lit.) |
| Siedepunkt | 314.4°C (rough estimate) |
| Dichte | 1.0781 (rough estimate) |
| Brechungsindex | 1.5570 (estimate) |
| Lagerbedingungen | Store at room temperature |
| Aggregatzustand | solid |
| InChI | 1S/C14H14O2/c1-15-13-7-3-11(4-8-13)12-5-9-14(16-2)10-6-12/h3-10H,1-2H3 |
| InChIKey | UIMPAOAAAYDUKQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1)-c2ccc(OC)cc2 |
| CAS Datenbank | 2132-80-1(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Sicherheitshinweise (S) | 24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
4,4′-Dimethoxybiphenyl was used to study the coupled methyl-group rotation and methoxy-group libration.