Identifikatoren & physikalische Daten
| CAS No. | 2298-13-7 |
|---|
| Summenformel | C14H16ClN3 |
|---|
| Durchschnittliche Molmasse | 261,75 g/mol |
|---|
| Monoisotopische Masse | 261,10327519 g/mol |
|---|
| SMILES | Cc1cc(N=Nc2ccccc2C)ccc1N.Cl |
|---|
| InChIKey | PUDCZUQFOPHIGU-UHFFFAOYSA-N |
|---|
| PubChem CID | 16808 |
|---|
| EC No. | 218-945-4 |
|---|
| DTXSID | DTXSID3062312 |
|---|
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 50,7 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 18 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 264 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH351 (100%): Suspected of causing cancer [Warning Carcinogenicity]P203, P280, P318, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Carc. 2 (100%) |
|---|
