HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 168787Erstellt: 27. Oktober 2026
Dichloro(dimethyl)silane--trichloro(phenyl)silane (1/1)
Silane, dichlorodimethyl-, polymer with trichlorophenylsilane
https://huagongshe.com/de/chemical/168787
Identifikatoren & physikalische Daten
| CAS No. | 28326-02-5 |
|---|
| Summenformel | C8H11Cl5Si2 |
|---|
| Durchschnittliche Molmasse | 340,6 g/mol |
|---|
| Monoisotopische Masse | 337,884192 g/mol |
|---|
| SMILES | C[Si](C)(Cl)Cl.Cl[Si](Cl)(Cl)c1ccccc1 |
|---|
| InChIKey | QIGCRTUTOPTJKA-UHFFFAOYSA-N |
|---|
| PubChem CID | 168787 |
|---|
| DTXSID | DTXSID20951020 |
|---|
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 0 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 0 |
|---|
| Frei drehbare Bindungen | 0 |
|---|
| Schwere Atome | 15 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 135 |
|---|
| EPA chemische Informationen | Silane, dichlorodimethyl-, polymer with trichlorophenylsilane (28326-02-5) |
|---|
Sicherheit & Vorschriften
| TSCA-Inventar-Status | TSCA listed |
|---|
