HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1,2,3,5-Tetrafluorobenzene
1,2,3,5-TetrafL · 4-flurobenzalcohol · 1,2,3,5-Tetrafluorobenzyl · 1,2,3,5-TETRAFLUOROBENZENE · 1,3,4,5-Tetrafluorobenzene · 1,2,4,6-Tetrafluorobenzene · benzene,1,2,3,5-tetrafluoro- · 1,2,3,5-Tetrafluorobenzene97%
Identifikatoren & physikalische Daten
| CAS No. | 2367-82-0 |
|---|---|
| Summenformel | C6H2F4 |
| Durchschnittliche Molmasse | 150,07 g/mol |
| Monoisotopische Masse | 150,00926294 g/mol |
| SMILES | Fc1cc(F)c(F)c(F)c1 |
| InChIKey | UHHYOKRQTQBKSB-UHFFFAOYSA-N |
| PubChem CID | 16910 |
| EC No. | 219-126-4 |
| DTXSID | DTXSID10178340 |
Chemische & physikalische Eigenschaften
| XLogP | 2,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 104 |
| SpringerMaterials Properties | Coriolis coupling |
| Schmelzpunkt | -48 °C |
| Siedepunkt | 83 °C(lit.) |
| Dichte | 1.393 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.404(lit.) |
| Flammpunkt | 40 °F |
| Lagerbedingungen | Refrigerator |
| Aggregatzustand | clear liquid |
| Farbe | Colorless to Almost colorless |
| Löslichkeit | 743.1mg/L(25 ºC) |
| Henry-Konstante | 5.1×10-4 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| InChI | InChI=1S/C6H2F4/c7-3-1-4(8)6(10)5(9)2-3/h1-2H |
| InChIKey | UHHYOKRQTQBKSB-UHFFFAOYSA-N |
| SMILES | C1(F)=CC(F)=CC(F)=C1F |
| CAS Datenbank | 2367-82-0(CAS DataBase Reference) |
| NIST chemische Informationen | Benzene, 1,2,3,5-tetrafluoro-(2367-82-0) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH225 (100%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 2 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 1993 3/PG 2 |
| Zollcode | 29039990 |
| R-Sätze (R) | 11-36/37/38 |
| Gefahrensymbole | F,Xi |
| hazard_note | Flammable/Irritant |
| Sicherheitshinweise (S) | 16-26-7-33-29-7/9 |
| Gefahrenklasse | 3.1Aquatic Chronic 2Eye Dam. 1Flam. Liq. 2 |
| Verpackungsgruppe | II |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
Intermediates of pharmaceuticals, pesticides, and liquid crystal materials.