HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
5,8-Diethyl-7-hydroxydodecan-6-on
7-Hydroxy-5,8-diethyldodecan-6-one · 5,8-Diethyl-7-hydroxy-6-dodecanone · 5,8-diethyl-7-hydroxydodecan-6-one · 6-Dodecanone, 5,8-diethyl-7-hydroxy-
Identifikatoren & physikalische Daten
| CAS No. | 31814-59-2 |
|---|---|
| Summenformel | C16H32O2 |
| Durchschnittliche Molmasse | 256,42 g/mol |
| Monoisotopische Masse | 256,24023026 g/mol |
| SMILES | CCCCC(CC)C(=O)C(O)C(CC)CCCC |
| InChIKey | RCEAKQYSPGVKEX-UHFFFAOYSA-N |
| PubChem CID | 169366 |
| EC No. | 250-818-9 |
| DTXSID | DTXSID20885518 |
| Lokaler Name | 5,8-Diethyl-7-hydroxydodecan-6-on |
Chemische & physikalische Eigenschaften
| XLogP | 5,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 37,3 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 11 |
| Schwere Atome | 18 |
| Formalladung | 0 |
| Komplexität | 213 |
| Siedepunkt | 128-136 °C(Press: 3 Torr) |
| Dichte | 0.889±0.06 g/cm3(Predicted) |
| Lagerbedingungen | -20°C Freezer, Under inert atmosphere |
| Löslichkeit | DichloromethaneEthyl Acetate |
| pKa (Säurekonstante) | 12.88±0.20(Predicted) |
| Aggregatzustand | Oil |
| Farbe | Yellow |
| EPA chemische Informationen | 6-Dodecanone, 5,8-diethyl-7-hydroxy- (31814-59-2) |
Sicherheit & Vorschriften
| TSCA-Inventar-Status | TSCA listed |
|---|
Anwendungen & Verwendung
Verwenden
5,8-Diethyl-7-hydroxy-6-dodecanone is an intermediate in synthesizing 5,8-Diethyl-7-hydroxy-6-dodecanone Oxime (D441795). A cationic extractant used to separate metals. For example, it can be used in the recovery of indium and gallium from a synthetic each solution of zinc refinery residues.