HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 170632905Erstellt: 1. November 2026
6-Bromo-3,4-dichloro-2-fluorobenzoic acid
6-bromo-3,4-dichloro-2-fluorobenzoic acid · Benzoic acid, 6-bromo-3,4-dichloro-2-fluoro-
https://huagongshe.com/de/chemical/170632905
Identifikatoren & physikalische Daten
| CAS No. | 3024471-16-4 |
|---|
| Summenformel | C7H2BrCl2FO2 |
|---|
| Durchschnittliche Molmasse | 287,89 g/mol |
|---|
| Monoisotopische Masse | 285,85993 g/mol |
|---|
| SMILES | O=C(O)c1c(Br)cc(Cl)c(Cl)c1F |
|---|
| InChIKey | RTFCGWONTXZFKC-UHFFFAOYSA-N |
|---|
| PubChem CID | 170632905 |
|---|
| EC No. | 986-038-7 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,5 |
|---|
| Polarare Oberfläche (TPSA) | 37,3 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 13 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 217 |
|---|
| Siedepunkt | 336.1±42.0 °C(predicted) |
|---|
| Dichte | 1.968±0.06 g/cm3(Temp: 20 °CPress: 760 Torr)(predicted) |
|---|
| pKa (Säurekonstante) | 1.32±0.10(predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
