Identifikatoren & physikalische Daten
| CAS No. | 2756832-64-9 |
|---|
| Summenformel | C12H25N3O3 |
|---|
| Durchschnittliche Molmasse | 259,35 g/mol |
|---|
| Monoisotopische Masse | 259,18959167 g/mol |
|---|
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)NCCCN |
|---|
| InChIKey | SXWYLPIAPHXOGJ-UHFFFAOYSA-N |
|---|
| PubChem CID | 175193604 |
|---|
| EC No. | 180-277-3 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 0 |
|---|
| Polarare Oberfläche (TPSA) | 93,5 |
|---|
| H-Brücken-Donoren | 3 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 9 |
|---|
| Schwere Atome | 18 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 262 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P332+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
|---|
![Molekülstruktur von tert-butyl N-{3-[(3-aminopropyl)carbamoyl]propyl}carbamate](/img/chemical/175193604.png)