HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N,N-Diethylacrylamide
DIETHYLACRYLAMIDE · N,N-diethylprop-2-enamide · DEAA · DEAAm · NSC 20951 · contains <n,n-diethyl-acrylamid · N,N-Diethylacrylamide · Alflutinib Impurity 11
Identifikatoren & physikalische Daten
| CAS No. | 2675-94-7 |
|---|---|
| Summenformel | C7H13NO |
| Durchschnittliche Molmasse | 127,18 g/mol |
| Monoisotopische Masse | 127,09971404 g/mol |
| SMILES | C=CC(=O)N(CC)CC |
| InChIKey | OVHHHVAVHBHXAK-UHFFFAOYSA-N |
| PubChem CID | 17583 |
| EC No. | 679-769-5 |
| DTXSID | DTXSID10181258 |
Chemische & physikalische Eigenschaften
| XLogP | 1 |
|---|---|
| Polarare Oberfläche (TPSA) | 20,3 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 105 |
| Schmelzpunkt | 93℃/19mm |
| Siedepunkt | 93-95°C 10mm |
| Dichte | 0.924 at 25 °C |
| Dampfdruck | 0.2-47.329Pa at 11.67-34.92℃ |
| Brechungsindex | 1.4676 (589.3 nm 20℃) |
| Flammpunkt | 88℃ |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | Soluble in water |
| pKa (Säurekonstante) | -0.77±0.70(Predicted) |
| Aggregatzustand | Liquid |
| Farbe | Colorless to Light yellow |
| InChI | InChI=1S/C7H13NO/c1-4-7(9)8(5-2)6-3/h4H,1,5-6H2,2-3H3 |
| InChIKey | OVHHHVAVHBHXAK-UHFFFAOYSA-N |
| SMILES | C(N(CC)CC)(=O)C=C |
| LogP (Verteilungskoeffizient) | 0.61-0.84 at 23-30℃ and pH7.17-7.28 |
| Oberflächenspannung | 66-67.6mN/m at 1g/L and 20-20.05℃ |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P280, P301+P317, P302+P352, P305+P351+P338, P321, P330, P332+P317, P337+P317, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 58 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | Status: Active Update: 16-05-2018 https://echa.europa.eu/registration-dossier/-/registered-dossier/23650 |
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 1993 / PGIII |
| Zollcode | 29241990 |
| RTECS-Nr. | AS3471000 |
| R-Sätze (R) | 20/21/22-36/37/38-51-36-22 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36/37/39 |
| Lagerklasse | 10 - Combustible liquids |
| Gefahrenklasse | Acute Tox. 4 OralEye Irrit. 2 |
Anwendungen & Verwendung
Verwenden
Acrylamide monomer used to make polymers for drug delivery; thermal responsive polymers; and solutions with specifically tuned LCSTs.