HRID 1812472als KatalysatorDataset from `Ultra-high-throughput mapping of the chemical space of asymmetric catalysis enables accelerated reaction discovery`
HCID 178505915, Verbindung
Grundinformationen
- Standard-SMILES
Fc1cc(F)c(-c2ccccn2)c([Ir]c2cc(F)cc(F)c2-c2ccccn2)c1.Fc1ccc(-c2ccccn2)c(F)c1
Zugehörige Reaktionen
110
HRID 1812473als KatalysatorDataset from `Ultra-high-throughput mapping of the chemical space of asymmetric catalysis enables accelerated reaction discovery`
HRID 1812474als KatalysatorDataset from `Ultra-high-throughput mapping of the chemical space of asymmetric catalysis enables accelerated reaction discovery`
HRID 1812475als KatalysatorDataset from `Ultra-high-throughput mapping of the chemical space of asymmetric catalysis enables accelerated reaction discovery`
HRID 1812476als KatalysatorDataset from `Ultra-high-throughput mapping of the chemical space of asymmetric catalysis enables accelerated reaction discovery`
HRID 1812477als KatalysatorDataset from `Ultra-high-throughput mapping of the chemical space of asymmetric catalysis enables accelerated reaction discovery`
HRID 1812478als KatalysatorDataset from `Ultra-high-throughput mapping of the chemical space of asymmetric catalysis enables accelerated reaction discovery`
HRID 1812479als KatalysatorDataset from `Ultra-high-throughput mapping of the chemical space of asymmetric catalysis enables accelerated reaction discovery`
Notizen zur Verbindung
Wird geladen…