HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(1-Allyl-1H-benzoimidazol-2-yl)-phenyl-methanol
(1-allyl-1H-benzo[d]imidazol-2-yl)(phenyl)methanol · phenyl[1-(prop-2-en-1-yl)-1H-benzimidazol-2-yl]methanol · 1H-Benzimidazole-2-methanol, α-phenyl-1-(2-propen-1-yl)-
Identifikatoren & physikalische Daten
| CAS No. | 36325-02-7 |
|---|---|
| Summenformel | C17H16N2O |
| Durchschnittliche Molmasse | 264,32 g/mol |
| SMILES | C=CCn1c(C(O)c2ccccc2)nc2ccccc21 |
| InChIKey | YPHATWPQCSCPCW-UHFFFAOYSA-N |
| ChEMBL | CHEMBL1526986 |
Chemische & physikalische Eigenschaften
| XLogP | 3 |
|---|---|
| Polarare Oberfläche (TPSA) | 38,1 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 20 |
| Formalladung | 0 |
| Komplexität | 327 |
| Löslichkeit | 24.2 [ug/mL] (The mean of the results at pH 7.4) |
| Siedepunkt | 473.7±45.0 °C(Predicted) |
| Dichte | 1.13±0.1 g/cm3(Predicted) |
| pKa (Säurekonstante) | 13.09±0.20(Predicted) |