HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1-(3,4-Difluoro-phenyl)-2-[1,2,4]triazol-1-yl-ethanone
Voriconazole Impurity 81 · Ethanone, 1-(3,4-difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)- · 1-(3,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethan-1-one · 1-(3,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanoneQ: What is 1-(3,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone Q: What is the CAS Number of 1-(3,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone
![Molekülstruktur von 1-(3,4-Difluoro-phenyl)-2-[1,2,4]triazol-1-yl-ethanone](/img/chemical/178644635.png)
Identifikatoren & physikalische Daten
| CAS No. | 351042-08-5 |
|---|---|
| Summenformel | C10H7F2N3O |
| Durchschnittliche Molmasse | 223,18 g/mol |
| Monoisotopische Masse | 223,05571818 g/mol |
| SMILES | O=C(Cn1cncn1)c1ccc(F)c(F)c1 |
| InChIKey | JRNODLCIGOCBKO-UHFFFAOYSA-N |
| PubChem CID | 723809 |
| ChEMBL | CHEMBL2063493 |
Chemische & physikalische Eigenschaften
| XLogP | 1,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 47,8 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 16 |
| Formalladung | 0 |
| Komplexität | 264 |
| Siedepunkt | 404.8±55.0 °C(Predicted) |
| Dichte | 1.39±0.1 g/cm3(Predicted) |
| pKa (Säurekonstante) | 2.03±0.10(Predicted) |