HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Phenylmethyl (2R,3S)-3-hydroxy-2-(2-oxopropyl)-1-piperidinecarboxylate
Ambroxol Impurity 64 · trans-N-Benzyloxycarbonyl 3-Hydroxy-2-(2-oxopropyl)piperidine · (2R,3S)-rel-3-Hydroxy-2-(2-oxopropyl)-1-piperidinecarboxylic Acid PhenylMethyl Ester · 1-Piperidinecarboxylic acid, 3-hydroxy-2-(2-oxopropyl)-, phenylmethyl ester, (2R,3S)-rel-
Identifikatoren & physikalische Daten
| CAS No. | 1091605-50-3 |
|---|---|
| Summenformel | C16H21NO4 |
| Durchschnittliche Molmasse | 291,34 g/mol |
| Monoisotopische Masse | 291,14705815 g/mol |
| SMILES | CC(=O)C[C@@H]1[C@@H](O)CCCN1C(=O)OCc1ccccc1 |
| InChIKey | QMZQCUOKMRKTCQ-CABCVRRESA-N |
| PubChem CID | 11323759 |
| DTXSID | DTXSID201153820 |
Chemische & physikalische Eigenschaften
| XLogP | 1,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 66,8 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 5 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 365 |
| Schmelzpunkt | 74-75 °C |
| Siedepunkt | 455.374±40.00 °C(Press: 760.00 Torr)(predicted) |
| Dichte | 1.194±0.06 g/cm3(Temp: 25 °CPress: 760 Torr)(predicted) |
| Löslichkeit | Chloroform |
| pKa (Säurekonstante) | 14.489±0.40(predicted) |
Anwendungen & Verwendung
Verwenden
Intermediate in the preparation of Halofuginone.