HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3-(4-methoxyphenyl)-2,2-dimethyl-1H-quinazolin-4-one
3-(4-methoxyphenyl)-2,2-dimethyl-2,3-dihydroquinazolin-4(1H)-one · 4(1H)-Quinazolinone, 2,3-dihydro-3-(4-methoxyphenyl)-2,2-dimethyl-
Identifikatoren & physikalische Daten
| CAS No. | 404835-88-7 |
|---|---|
| Summenformel | C17H18N2O2 |
| Durchschnittliche Molmasse | 282,34 g/mol |
| Monoisotopische Masse | 282,13682782 g/mol |
| SMILES | COc1ccc(N2C(=O)c3ccccc3NC2(C)C)cc1 |
| InChIKey | RPLFBIOEIFQSEL-UHFFFAOYSA-N |
| PubChem CID | 919612 |
| ChEMBL | CHEMBL1578017 |
Chemische & physikalische Eigenschaften
| XLogP | 3,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 41,6 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 388 |
| Löslichkeit | 8.3 [ug/mL] (The mean of the results at pH 7.4) |
| Siedepunkt | 468.3±45.0 °C(Predicted) |
| Dichte | 1.145±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | 1.42±0.40(Predicted) |