HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Fluconazole N-Oxide
Fluconazole N4-Oxide · 1H-1,2,4-Triazole-1-ethanol, α-(2,4-difluorophenyl)-α-(1H-1,2,4-triazol-1-ylmethyl)-, 4-oxide · 1-(2-(2,4-Difluorophenyl)-2-hydroxy-3-(1H-1,2,4-triazol-1-yl)propyl)-1H-1,2,4-triazole 4-oxide (Efinaconazole?Impurity)
Identifikatoren & physikalische Daten
| CAS No. | 1997296-62-4 |
|---|---|
| Summenformel | C13H12F2N6O2 |
| Durchschnittliche Molmasse | 322,27 g/mol |
| Monoisotopische Masse | 322,09897997 g/mol |
| SMILES | [O-][n+]1cnn(CC(O)(Cn2cncn2)c2ccc(F)cc2F)c1 |
| InChIKey | QEEPILPFZHXTDA-UHFFFAOYSA-N |
| PubChem CID | 154789972 |
Chemische & physikalische Eigenschaften
| XLogP | 0,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 94,2 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 7 |
| Frei drehbare Bindungen | 5 |
| Schwere Atome | 23 |
| Formalladung | 0 |
| Komplexität | 409 |
| Arzneimittel | Pharmaceuticals -> Metabolite of Fluconazole |
| Siedepunkt | 622.0±65.0 °C(Predicted) |
| Dichte | 1.54±0.1 g/cm3(Predicted) |
| Löslichkeit | DMSO (Slightly), Methanol (Slightly) |
| pKa (Säurekonstante) | 11.29±0.29(Predicted) |
| Aggregatzustand | Solid |
| Farbe | White to Off-White |
Anwendungen & Verwendung
Verwenden
Fluconazole N-Oxide is a possible metabolite of Fluconazole (F421000).