HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Benzenesulfonamide, N-(phenylmethylene)-
N-Benzylidenebenzenesulfonamide · N-BENZYLIDINE BENZENESULFONAMIDE · N-(Phenylsulfonyl)benzylideneamine · N-Benzylidenebenzenesulfonamide >N-(Phenylsulfonyl)phenylmethaneimine · N-BENZYLIDENEBENZENESULFONAMIDE 97% · N-(PhenylMethylene)benzenesulfonaMide · Benzenesulfonamide, N-(phenylmethylene)- · N-BENZYLIDENEBENZENESULFONAMIDE ISO 9001：2015 REACH
Identifikatoren & physikalische Daten
| CAS No. | 13909-34-7 |
|---|---|
| Summenformel | C13H11NO2S |
| Durchschnittliche Molmasse | 245,3 g/mol |
| Monoisotopische Masse | 245,05104977 g/mol |
| SMILES | O=S(=O)(/N=C/c1ccccc1)c1ccccc1 |
| InChIKey | MPNRJEPBAYEQBY-SDNWHVSQSA-N |
| PubChem CID | 9602006 |
Chemische & physikalische Eigenschaften
| XLogP | 2,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 54,9 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 17 |
| Formalladung | 0 |
| Komplexität | 344 |
| Schmelzpunkt | 78-81 °C(lit.) |
| Siedepunkt | 406.3±28.0 °C(Predicted) |
| Dichte | 1.16±0.1 g/cm3(Predicted) |
| Lagerbedingungen | room temp |
| Löslichkeit | Chloroform, DCM |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | -4.08±0.50(Predicted) |
| Farbe | White |
| BRN | 1964884 |
| Hauptanwendungen | diagnostic assay manufacturinghematologyhistology |
| InChI | 1S/C13H11NO2S/c15-17(16,13-9-5-2-6-10-13)14-11-12-7-3-1-4-8-12/h1-11H/b14-11+ |
| InChIKey | MPNRJEPBAYEQBY-SDNWHVSQSA-N |
| SMILES | O=S(=O)(\N=C\c1ccccc1)c2ccccc2 |
Sicherheit & Vorschriften
| Regulatorische Informationen | Benzenesulfonamide, N-(phenylmethylene)-: Does not have an individual approval but may be used under an appropriate group standard |
|---|---|
| F | 8-10-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 2935.90.9500 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
Anwendungen & Verwendung
Verwenden
N-(Phenylmethylene)benzenesulfonamide is an intermediate in the synthesis of Davis Oxaziridine (D194900), an oxidizing agent used in the preparation of wide variety of pharmaceutical compounds. Dyes and metabolites.