HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Myxinol
Myxinol · 5α-Cholestane-3β,7α,16α,26-tetraol · Cholestane-3,7,16,26-tetrol, (3β,5α,7α,16α)-
Identifikatoren & physikalische Daten
| CAS No. | 16812-98-9 |
|---|---|
| Summenformel | C27H48O4 |
| Durchschnittliche Molmasse | 436,7 g/mol |
| SMILES | CC(CO)CCC[C@@H](C)[C@H]1[C@H](O)C[C@H]2[C@@H]3[C@H](O)C[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChIKey | NHNHDZACHWAKJW-NSPSUJRFSA-N |
Chemische & physikalische Eigenschaften
| XLogP | 5,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 80,9 |
| H-Brücken-Donoren | 4 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 6 |
| Schwere Atome | 31 |
| Formalladung | 0 |
| Komplexität | 624 |
| Lipide | Lipids -> Sterol Lipids [ST] -> Bile acids and derivatives [ST04] -> C27 bile acids, alcohols, and derivatives [ST0403] |
| Schmelzpunkt | 206 °C |
| Siedepunkt | 572.6±35.0 °C(Predicted) |
| Dichte | 1.098±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | 14.71±0.70(Predicted) |