HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Mapenterol
1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-(2-methylbutan-2-ylamino)ethanol · Benzenemethanol, 4-amino-3-chloro-α-[[(1,1-dimethylpropyl)amino]methyl]-5-(trifluoromethyl)-
Identifikatoren & physikalische Daten
| CAS No. | 95656-68-1 |
|---|---|
| Summenformel | C14H20ClF3N2O |
| Durchschnittliche Molmasse | 324,77 g/mol |
| Monoisotopische Masse | 324,1216254 g/mol |
| SMILES | CCC(C)(C)NCC(O)c1cc(Cl)c(N)c(C(F)(F)F)c1 |
| InChIKey | KGOIKOVSEVRHNH-UHFFFAOYSA-N |
| PubChem CID | 178787 |
| DTXSID | DTXSID10914886 |
Chemische & physikalische Eigenschaften
| XLogP | 3 |
|---|---|
| Polarare Oberfläche (TPSA) | 58,3 |
| H-Brücken-Donoren | 3 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 5 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 339 |
| Collision Cross Section | 172.36 Ų [M+H]+ |
Anwendungen & Verwendung
Verwenden
Mapenterol is the free base of Mapenterol Hydrochloride (M187000) which is a related drug of Clenbuterol (C569998), a β-agonist which can be used as a growth promoter in farm animals.