HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-(Acetyloxy)-3-methoxybenzenethanol Acetate
4-(Acetyloxy)-3-Methoxybenzenethanol Acetate · Benzeneethanol, 4-(acetyloxy)-3-methoxy-, 1-acetate
Identifikatoren & physikalische Daten
| CAS No. | 32022-28-9 |
|---|---|
| Summenformel | C13H16O5 |
| Durchschnittliche Molmasse | 252,26 g/mol |
| SMILES | COc1cc(CCOC(C)=O)ccc1OC(C)=O |
| InChIKey | XKNYEIJAGJNUPM-UHFFFAOYSA-N |
Chemische & physikalische Eigenschaften
| XLogP | 1,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 61,8 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 7 |
| Schwere Atome | 18 |
| Formalladung | 0 |
| Komplexität | 289 |
| Siedepunkt | 330.2±32.0 °C(Predicted) |
| Dichte | 1.144±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Refrigerator |
| Löslichkeit | Chloroform, DMSO |
| Aggregatzustand | Solid |
| Farbe | White Low Melting |
Anwendungen & Verwendung
Verwenden
4-Hydroxy-3-methoxyphenethyl Alcohol Diacetate is a derivative of Tyrosol (T947800), an phenolic antioxidant that could be extracted from olive oil.