HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
CID 131667810
N,N'-Trityl Losartan IMpurity B · N,N’-Ditrityl Losartan α-Butyl-losartan Aldehyde Adduct · α-[2-Butyl-4-chloro-1-[[2'-[1-(triphenylMethyl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]Methyl]-1H-iMidazol-5-yl]-4-chloro-5-(hydroxyMethyl)-β-propyl-1-[[2'-[1-(triphenylMethyl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]Methyl]-1H-iMidazole-2-ethanol · 1H-Imidazole-2-ethanol, α-[2-butyl-4-chloro-1-[[2'-[1-(triphenylmethyl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]methyl]-1H-imidazol-5-yl]-4-chloro-5-(hydroxymethyl)-β-propyl-1-[[2'-[1-(triphenylmethyl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]methyl]-
Identifikatoren & physikalische Daten
| CAS No. | 1246818-06-3 |
|---|---|
| Summenformel | C82H72Cl2N12O2 |
| Durchschnittliche Molmasse | 1.328,4 g/mol |
| SMILES | CCCCc1nc(Cl)c(C(O)C(CCC)c2nc(Cl)c(CO)n2Cc2ccc(-c3ccccc3-c3nnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)cc2)n1Cc1ccc(-c2ccccc2-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1 |
| InChIKey | XEYMCSXYSGGQHF-UHFFFAOYSA-N |
Chemische & physikalische Eigenschaften
| XLogP | 19 |
|---|---|
| Polarare Oberfläche (TPSA) | 163 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 10 |
| Frei drehbare Bindungen | 25 |
| Schwere Atome | 98 |
| Formalladung | 0 |
| Komplexität | 2.240 |
| Schmelzpunkt | 154-158°C |
| Dichte | 1.26±0.1 g/cm3(Predicted) |
| Lagerbedingungen | Refrigerator |
| Löslichkeit | Chloroform, Methanol |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 13.03±0.20(Predicted) |
| Farbe | Off-White to Pale Yellow |
Anwendungen & Verwendung
Verwenden
Intermediate in the production of Losartan impurities