HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
ethyl [(4-oxido-2-oxo-3-phenylquinoxalin-1(2H)-yl)oxy]acetate
ethyl [(4-oxido-2-oxo-3-phenyl-1(2H)-quinoxalinyl)oxy]acetate · Acetic acid, 2-[(4-oxido-2-oxo-3-phenyl-1(2H)-quinoxalinyl)oxy]-, ethyl ester
![Molekülstruktur von ethyl [(4-oxido-2-oxo-3-phenylquinoxalin-1(2H)-yl)oxy]acetate](/img/chemical/178934021.png)
Identifikatoren & physikalische Daten
| CAS No. | 374919-16-1 |
|---|---|
| Summenformel | C18H16N2O5 |
| Durchschnittliche Molmasse | 340,3 g/mol |
| SMILES | CCOC(=O)COn1c(=O)c(-c2ccccc2)[n+]([O-])c2ccccc21 |
| InChIKey | FRBYBEMPGDPUPP-UHFFFAOYSA-N |
| ChEMBL | CHEMBL1336038 |
Chemische & physikalische Eigenschaften
| XLogP | 1,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 84,6 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 6 |
| Schwere Atome | 25 |
| Formalladung | 0 |
| Komplexität | 542 |
| Löslichkeit | 35.2 [ug/mL] (The mean of the results at pH 7.4) |
| Siedepunkt | 510.9±52.0 °C(Predicted) |
| Dichte | 1.36±0.1 g/cm3(Predicted) |
| pKa (Säurekonstante) | -1.82±0.20(Predicted) |