HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Di-O-methyldemethoxycurcumin
Di-O-methyldemethoxycurcumin · 1,6-Heptadiene-3,5-dione, 1-(3,4-dimethoxyphenyl)-7-(4-methoxyphenyl)-, (1E,6E)- · Di-O-methyldemethoxycurcumin/(1E,6E)-1-(3,4-Dimethoxyphenyl)-7-(4-methoxyphenyl)-1,6-heptadiene-3,5-dione
Identifikatoren & physikalische Daten
| CAS No. | 824951-60-2 |
|---|---|
| Summenformel | C22H22O5 |
| Durchschnittliche Molmasse | 366,4 g/mol |
| SMILES | COc1ccc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC)c(OC)c2)cc1 |
| InChIKey | FTMVHEMEBLBNPN-LUZURFALSA-N |
| ChEMBL | CHEMBL1088196 |
Chemische & physikalische Eigenschaften
| XLogP | 3,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 61,8 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 9 |
| Schwere Atome | 27 |
| Formalladung | 0 |
| Komplexität | 531 |
| Siedepunkt | 568.4±50.0 °C(Predicted) |
| Dichte | 1.163±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Store at -20°C, sealed storage, away from moisture and light |
| pKa (Säurekonstante) | 8.19±0.46(Predicted) |
| Aggregatzustand | Solid |
| Farbe | White to yellow |