HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
5-(4-Bromophenyl)cyclohexane-1,3-dione
5-(4-Bromophenyl) · 5-(4-broMophenyl)-1,3-Cyclohexanedione · 1,3-Cyclohexanedione, 5-(4-broMophenyl)- · 5-(4-Bromo-phenyl)-cyclohexane-1,3-dione · 5-(4-Bromophenyl)-3-hydroxy-cyclohex-2-en-1-one · 5-(4-Bromophenyl)-3-hydroxycyclohex-2-ene-1-one
Identifikatoren & physikalische Daten
| CAS No. | 239132-48-0 |
|---|---|
| Summenformel | C12H11BrO2 |
| Durchschnittliche Molmasse | 267,12 g/mol |
| Monoisotopische Masse | 265,99424 g/mol |
| SMILES | O=C1CC(=O)CC(c2ccc(Br)cc2)C1 |
| InChIKey | GQCQFGJLUYXUAG-UHFFFAOYSA-N |
| PubChem CID | 18317613 |
| DTXSID | DTXSID30592746 |
Chemische & physikalische Eigenschaften
| XLogP | 2,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 34,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 251 |
| Siedepunkt | 400.5±45.0 °C(Predicted) |
| Dichte | 1.485±0.06 g/cm3(Predicted) |
| Lagerbedingungen | 2-8°C |
| pKa (Säurekonstante) | 4.84±0.20(Predicted) |
Sicherheit & Vorschriften
| Zollcode | 2914290090 |
|---|
Anwendungen & Verwendung
Verwenden
5-(4-Bromo-phenyl)-cyclohexane-1,3-dione is mainly used as a pharmaceutical intermediate for the synthesis of drug molecules containing bromophenylcyclohexanedione structures.