5-Nitro-2-furfurolsemicarbazon
NFS · NF · semicarbazone · FURACILIN · NITROFURAL · Nitrofurazon · 5-NITRO-2-FURALDEHYDE SEMICARBAZONE · Actin-N
Identifikatoren & physikalische Daten
| CAS No. | 59-87-0 |
|---|---|
| Summenformel | C6H6N4O4 |
| Durchschnittliche Molmasse | 198,14 g/mol |
| Monoisotopische Masse | 198,03890469 g/mol |
| SMILES | NC(=O)NN=Cc1ccc([N+](=O)[O-])o1 |
| InChIKey | IAIWVQXQOWNYOU-UHFFFAOYSA-N |
| PubChem CID | 1839 |
| ChEMBL | CHEMBL1603968 |
| DTXSID | DTXSID5020944 |
| Lokaler Name | 5-Nitro-2-furfurolsemicarbazon |
Chemische & physikalische Eigenschaften
| XLogP | 0,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 126 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 261 |
| SpringerMaterials Properties | Crystal structure |
| LogP (Verteilungskoeffizient) | 0.74 |
| Animal Drugs | Pharmaceuticals -> Animal Drugs -> Approved in Taiwan |
| Schmelzpunkt | 242-244 °C (lit.) |
| Siedepunkt | 335.43°C (rough estimate) |
| Dichte | 1.6031 (rough estimate) |
| Brechungsindex | 1.6500 (estimate) |
| Flammpunkt | 2 °C |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | Very slightly soluble in water, slightly soluble in ethanol (96 per cent).<0.1 g/100 mL at 19 ºC |
| pKa (Säurekonstante) | pKa 9.28± 0.03( EtOH,t =35±0.1,I=0.00) (Uncertain) |
| Aggregatzustand | Solid |
| Farbe | Yellow to Dark Yellow |
| Merck | 14,6600 |
| BRN | 86403 |
| Hauptanwendungen | pharmaceutical (small molecule) |
| Kosmetik-Inhaltsstoffe Funktionen | ANTIMICROBIAL |
| InChI | 1S/C6H6N4O4/c7-6(11)9-8-3-4-1-2-5(14-4)10(12)13/h1-3H,(H3,7,9,11)/b8-3+ |
| InChIKey | IAIWVQXQOWNYOU-FPYGCLRLSA-N |
| SMILES | NC(=O)N\N=C\c1ccc(o1)[N+]([O-])=O |
| CAS Datenbank | 59-87-0(CAS DataBase Reference) |
| NIST chemische Informationen | 5-Nitro furfural semicarbazone(59-87-0) |
| EPA chemische Informationen | Nitrofurazone (59-87-0) |
Sicherheit & Vorschriften
| F | 8 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | 3249 |
| Zollcode | 29321900 |
| RTECS-Nr. | LT7700000 |
| R-Sätze (R) | 22-36-20/21/22-11 |
| Toxizität | LD50 in rats (g/kg): 0.59 orally3.0 s.c. (Godwin) |
| Gefahrensymbole | Xn,F |
| Sicherheitshinweise (S) | 36-36/37-26-16 |
| Gefahrenklasse | 6.1(b)Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralEye Irrit. 2Flam. Liq. 2 |
| Verpackungsgruppe | III |
| Lagerklasse | 3 - Flammable liquids |
| Gefahrstoffdaten | 59-87-0(Hazardous Substances Data) |
Anwendungen & Verwendung
Beschreibung
Nitrofurazone is an antibacterial agent used in animal feed. Occupational dermatitis was reported in cattle breeders and farmers.
Verwenden
Nitrofurazone is a topical anti-infective and bactericide for most pathogens commonly causing surface infections; in the adjunctive therapy of patients with second and third degree bums when bacterial resistance to other agents is areal or potential problem; in skin grafting where bacterial contamination may cause graft rejection and/or donor-site infection; antibacterial agent for the treatment or prevention of infections in a variety of conditions involving skin, eyes, ears, nose and genito-urinary tract; used on pyodermas, ulcers, and wounds; affects some protozoa and is an effective prophylaxis against nosocomial infections; antiseptic lubricant for trans urethral resection; anti-microbial in veterinary medicine.