HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Oxobornan-10-sulfonsure
CSA · D-CAMPHORSULFONIC ACID · (+)-CSA · (1S)-(+)-10-CAMPHORSULFONIC ACID · CaMsylate · MOT · D-CAMPHOR-10-SULFONIC ACID · (+)-Camphorsulfonic acid
Identifikatoren & physikalische Daten
| CAS No. | 3144-16-9 |
|---|---|
| Summenformel | C10H16O4S |
| Durchschnittliche Molmasse | 232,3 g/mol |
| Monoisotopische Masse | 232,07692999 g/mol |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2 |
| InChIKey | MIOPJNTWMNEORI-UHFFFAOYSA-N |
| PubChem CID | 18462 |
| ChEMBL | CHEMBL5596548 |
| ChEBI | CHEBI:55379 |
| EC No. | 200-949-2 |
| DTXSID | DTXSID60863113 |
| Lokaler Name | 2-Oxobornan-10-sulfonsure |
Chemische & physikalische Eigenschaften
| XLogP | 0,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 79,8 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 404 |
| Schmelzpunkt | 196-200 °C (dec.)(lit.) |
| Siedepunkt | 344.46°C (rough estimate) |
| Dichte | 1.2981 (rough estimate) |
| Brechungsindex | 21.5 ° (C=5, H2O) |
| Lagerbedingungen | Store below +30°C. |
| Löslichkeit | Exhibit moderate solubility in HCCl.SOLUBLE |
| Aggregatzustand | Crystalline Powder |
| pKa (Säurekonstante) | 1.17±0.50(Predicted) |
| Farbe | White to off-white |
| pH | 0.3 (200g/l, H2O) |
| Biologische Quelle | human |
| Merck | 14,1734 |
| BRN | 2809675 |
| Stabilität | Stable. Protect from moisture. Incompatible with strong oxidizing agents, strong bases. |
| InChI | 1S/C10H16O4S/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h7H,3-6H2,1-2H3,(H,12,13,14)/t7-,10-/m1/s1 |
| InChIKey | MIOPJNTWMNEORI-GMSGAONNSA-N |
| SMILES | [H][C@@]12CC[C@@](CS(O)(=O)=O)(C(=O)C1)C2(C)C |
| CAS Datenbank | 3144-16-9(CAS DataBase Reference) |
| EPA chemische Informationen | Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo-, (1S,4R)- (3144-16-9) |
Sicherheit & Vorschriften
| Regulatorische Informationen | Chemical: Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo-, (1S)- |
|---|---|
| F | 3-10 |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 3261 8/PG 2 |
| Zollcode | 29147090 |
| RTECS-Nr. | ED1550000 |
| R-Sätze (R) | 34 |
| Gefahrensymbole | C |
| Sicherheitshinweise (S) | 26-36/37/39-45-25-27 |
| Gefahrenklasse | 8Eye Dam. 1Met. Corr. 1Skin Corr. 1B |
| Verpackungsgruppe | III |
| Lagerklasse | 8A - Combustible corrosive hazardous materials |
Anwendungen & Verwendung
Verwenden
Used as a resolving agent, and as a catalyst for coupling dipeptides.