HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-Nitrobenzyl methanesulfonate
4-Nitrobenzyl Mesylate · p-Nitrobenzyl mesylate · 4-Nitrobenzyl methanesulfonate · p-Nitrobenzyl mesylate, Alkylation reagent · Benzenemethanol, 4-nitro-, 1-methanesulfonate
Identifikatoren & physikalische Daten
| CAS No. | 39628-94-9 |
|---|---|
| Summenformel | C8H9NO5S |
| Durchschnittliche Molmasse | 231,23 g/mol |
| Monoisotopische Masse | 231,02014356 g/mol |
| SMILES | CS(=O)(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChIKey | QZIYKAFPHRTIAI-UHFFFAOYSA-N |
| PubChem CID | 18924794 |
Chemische & physikalische Eigenschaften
| XLogP | 1 |
|---|---|
| Polarare Oberfläche (TPSA) | 97,6 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 307 |
| Siedepunkt | 449.4±28.0 °C(Predicted) |
| Dichte | 1.431±0.06 g/cm3(Predicted) |
| Lagerbedingungen | -10 to -25°C |
| Löslichkeit | DMSO: 100 mM |
| Aggregatzustand | A solid |
| Farbe | white to beige |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | WGK 3 |
|---|---|
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
4-Nitrobenzyl Mesylate is used to develop thiophosphate ester epitopes which can be recognized by antibodies. 4-Nitrobenzyl Mesylate can be used to study protein phosphorylation and map signaling network architecture.