HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 19087887Erstellt: 4. November 2026
3,5-Dichloro-4-cyanobenzoic acid
3,5-Dichloro-4-cyanobenzoic acid · Benzoic acid, 3,5-dichloro-4-cyano-
https://huagongshe.com/de/chemical/19087887
Identifikatoren & physikalische Daten
| CAS No. | 90008-06-3 |
|---|
| Summenformel | C8H3Cl2NO2 |
|---|
| Durchschnittliche Molmasse | 216,02 g/mol |
|---|
| Monoisotopische Masse | 214,9540837 g/mol |
|---|
| SMILES | N#Cc1c(Cl)cc(C(=O)O)cc1Cl |
|---|
| InChIKey | SXHGNXVZHQRYSN-UHFFFAOYSA-N |
|---|
| PubChem CID | 19087887 |
|---|
| EC No. | 171-787-7 |
|---|
| DTXSID | DTXSID60597941 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,4 |
|---|
| Polarare Oberfläche (TPSA) | 61,1 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 13 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 248 |
|---|
| Schmelzpunkt | 252-254 °C |
|---|
| Siedepunkt | 407.5±45.0 °C(Predicted) |
|---|
| Dichte | 1.62±0.1 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 2.80±0.10(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
