HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
L-Lysine, 2-((2-(ethoxycarbonyl)-4-oxo-4H-1-benzopyran-5-yl)oxy)-1-(((2-(ethoxycarbonyl)-4-oxo-4H-1-benzopyran-5-yl)oxy)methyl)ethyl ester
ethyl 5-[2-[(2S)-2,6-diaminohexanoyl]oxy-3-(2-ethoxycarbonyl-4-oxo-chromen-5-yl)oxy-propoxy]-4-oxo-chromene-2-carboxylate · L-Lysine, 2-[[2-(ethoxycarbonyl)-4-oxo-4H-1-benzopyran-5-yl]oxy]-1-[[[2-(ethoxycarbonyl)-4-oxo-4H-1-benzopyran-5-yl]oxy]methyl]ethyl ester
Identifikatoren & physikalische Daten
| CAS No. | 110816-79-0 |
|---|---|
| Summenformel | C33H36N2O12 |
| Durchschnittliche Molmasse | 652,6 g/mol |
| Monoisotopische Masse | 652,22682459 g/mol |
| SMILES | CCOC(=O)c1cc(=O)c2c(OCC(COc3cccc4oc(C(=O)OCC)cc(=O)c34)OC(=O)[C@@H](N)CCCCN)cccc2o1 |
| InChIKey | NGJJDHCBOKNREV-FQEVSTJZSA-N |
| PubChem CID | 196639 |
| ChEMBL | CHEMBL3560664 |
| ChEBI | CHEBI:31438 |
| DTXSID | DTXSID5057620 |
Chemische & physikalische Eigenschaften
| XLogP | 3,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 202 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 14 |
| Frei drehbare Bindungen | 19 |
| Schwere Atome | 47 |
| Formalladung | 0 |
| Komplexität | 1.130 |
Anwendungen & Verwendung
Verwenden
Cromoglicate Lisetil is used in identification of non-nucleoside human ribonucleotide reductase modulators and their antitumor activity.