HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Phosphoramidothioic acid, dimethyl-, O-ethyl ester, O-ester with N,N-dimethyl-p-hydroxybenzenesulfonamide
Dimethylaminophosphonothioic acid O-ethyl O-[4-(dimethylaminosulfonyl)phenyl] ester · Phosphoramidothioic acid, dimethyl-, O-ethyl ester, O-ester with p-hydroxy-N,N-dimethylbenzenesulfonamide (7CI,8CI)
Identifikatoren & physikalische Daten
| CAS No. | 2080-96-8 |
|---|---|
| Summenformel | C12H21N2O4PS2 |
| Durchschnittliche Molmasse | 352,4 g/mol |
| Monoisotopische Masse | 352,0680365 g/mol |
| SMILES | CCOP(=S)(Oc1ccc(S(=O)(=O)N(C)C)cc1)N(C)C |
| InChIKey | SUCZUNWECMAPNI-UHFFFAOYSA-N |
| PubChem CID | 200432 |
| DTXSID | DTXSID70943011 |
Chemische & physikalische Eigenschaften
| XLogP | 2,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 99,6 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 7 |
| Frei drehbare Bindungen | 7 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 468 |
| Siedepunkt | 425.7±55.0 °C(Predicted) |
| Dichte | 1.285±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | -1.71±0.70(Predicted) |