HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 20121482Erstellt: 4. November 2026
N-((2-nitrophenyl)methyl)cyclopropanamine
N-[(2-nitrophenyl)methyl]cyclopropanamine · Benzenemethanamine, N-cyclopropyl-2-nitro-
https://huagongshe.com/de/chemical/20121482
Identifikatoren & physikalische Daten
| CAS No. | 884501-98-8 |
|---|
| Summenformel | C10H12N2O2 |
|---|
| Durchschnittliche Molmasse | 192,21 g/mol |
|---|
| Monoisotopische Masse | 192,08987763 g/mol |
|---|
| SMILES | O=[N+]([O-])c1ccccc1CNC1CC1 |
|---|
| InChIKey | YEKQXQGNWNIMBG-UHFFFAOYSA-N |
|---|
| PubChem CID | 20121482 |
|---|
| EC No. | 967-143-7 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2 |
|---|
| Polarare Oberfläche (TPSA) | 57,9 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 14 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 211 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P261, P264, P270, P271, P280, P301+P317, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P319, P321, P330, P363, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Zollcode | 2921490090 |
|---|
