Identifikatoren & physikalische Daten
| CAS No. | 144671-97-6 |
|---|
| Summenformel | C27H32N4O2 |
|---|
| Durchschnittliche Molmasse | 444,6 g/mol |
|---|
| SMILES | O.O=c1[nH]c2ccccc2n1CCCN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
|---|
| InChIKey | WUVRHFANMRXNRX-UHFFFAOYSA-N |
|---|
| PubChem CID | 20506331 |
|---|
| EC No. | 689-147-5 |
|---|
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 39,8 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 7 |
|---|
| Schwere Atome | 33 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 574 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 7 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
