HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Acetylmandelate
(R)-2-acetoxy-2-phenylacetic acid · (-)-D-Mandelic acid acetate · 2(R)-acetoxy-2-phenylacetic acid · -D-mandeL · (-)-O-AcetyL · Mandelic acid 12 · (-)-O-Acetylmandelic acid · R - 0 - ACETYLMANDELIC ACID
Identifikatoren & physikalische Daten
| CAS No. | 51019-43-3 |
|---|---|
| Summenformel | C10H10O4 |
| Durchschnittliche Molmasse | 194,18 g/mol |
| Monoisotopische Masse | 194,0579088 g/mol |
| SMILES | CC(=O)OC(=O)C(O)c1ccccc1 |
| InChIKey | DQVWXLRNCXQVKH-UHFFFAOYSA-N |
| PubChem CID | 20537972 |
| DTXSID | DTXSID70965293 |
Chemische & physikalische Eigenschaften
| XLogP | 0,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 63,6 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 218 |
| Schmelzpunkt | 97-99 °C(lit.) |
| Siedepunkt | 317.8±30.0 °C(Predicted) |
| Dichte | 1.259±0.06 g/cm3(Predicted) |
| Brechungsindex | -153 ° (C=2, Acetone) |
| Lagerbedingungen | Inert atmosphere,Store in freezer, under -20°C |
| Löslichkeit | Soluble in methanol. (almost transparency) |
| pKa (Säurekonstante) | 2.76±0.10(Predicted) |
| Aggregatzustand | powder to crystal |
| Farbe | White to Almost white |
| BRN | 2694110 |
| Kosmetik-Inhaltsstoffe Funktionen | BUFFERING |
| InChI | InChI=1/C10H10O4/c1-7(11)14-9(10(12)13)8-5-3-2-4-6-8/h2-6,9H,1H3,(H,12,13)/t9-/s3 |
| InChIKey | YCCSWLJUVZBEAS-SECBINFHSA-N |
| SMILES | [C@@H](C1C=CC=CC=1)(C(=O)O)OC(=O)C |&1:0,r| |
| LogP (Verteilungskoeffizient) | 1.780 (est) |
| CAS Datenbank | 51019-43-3(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29181990 |
| R-Sätze (R) | 36/37/38 |
| Sicherheitshinweise (S) | 22-24/25-60-37-26 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
The (R)- and (S)-isomers are chiral derivatizing agents for NMR determination of enantiomeric purity of α-deuterated carboxylic acids, alcohols, and amines.