Identifikatoren & physikalische Daten
| CAS No. | 30460-38-9 |
|---|
| Summenformel | C20H34O6 |
|---|
| Durchschnittliche Molmasse | 370,5 g/mol |
|---|
| Monoisotopische Masse | 370,23553881 g/mol |
|---|
| SMILES | CC1(C)[C@H](O)C[C@H]2[C@](C)(O)[C@@H]3CCC4[C@H](O)C3(C[C@@H](O)[C@@]21O)C[C@@]4(C)O |
|---|
| InChIKey | BWMFRQKICHXLSH-PMDFNMFYSA-N |
|---|
| PubChem CID | 207666 |
|---|
| DTXSID | DTXSID80952790 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 0,3 |
|---|
| Polarare Oberfläche (TPSA) | 121 |
|---|
| H-Brücken-Donoren | 6 |
|---|
| H-Brücken-Akzeptoren | 6 |
|---|
| Frei drehbare Bindungen | 0 |
|---|
| Schwere Atome | 26 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 623 |
|---|
Sicherheit & Vorschriften
| Treatment | Medical treatment is not often needed but sometimes atropine therapy, vasopressors and other agents are used to mitigate symptoms. (L1251) |
|---|
| Gesundheitliche Auswirkungen | Grayanotoxins affect the nervous system but are not usually fatal. (L1251) |
|---|
| Expositionspfade | Oral (ingestion) (L1817)dermal (L1817) |
|---|
| Toxizitätsübersicht | Grayanotoxins bind to specific sodium ion channels in cell membranes. The grayanotoxins prevent inactivation, leaving excitable cells depolarized. (L1251) |
|---|
| Signs and Symptoms | Initial symptoms include excessive salivation, perspiration, vomiting, dizziness, weakness and paresthesia in the extremities and around the mouth, low blood pressure and sinus bradycardia. In higher doses symptoms can include loss of coordination, severe and progressive muscular weakness, bradycardia (and, paradoxically, ventricular tachycardia), and nodal rhythm or Wolff-Parkinson-White syndrome. (L1251) |
|---|
| Carcinogen Classification | No indication of carcinogenicity to humans (not listed by IARC). |
|---|
