HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 20853Erstellt: 27. Oktober 2026
1-Naphthaleneethanamine
1-NaphthaleneethanaMine HCl · 3-(naphthalen-1-yl)propan-1-amine hydrochloride
https://huagongshe.com/de/chemical/20853
Identifikatoren & physikalische Daten
| CAS No. | 4735-50-6 |
|---|
| Summenformel | C12H13N |
|---|
| Durchschnittliche Molmasse | 171,24 g/mol |
|---|
| Monoisotopische Masse | 171,10479942 g/mol |
|---|
| SMILES | NCCc1cccc2ccccc12 |
|---|
| InChIKey | RUJHATQMIMUYKD-UHFFFAOYSA-N |
|---|
| PubChem CID | 20853 |
|---|
| EC No. | 870-773-4 |
|---|
| DTXSID | DTXSID90197115 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,9 |
|---|
| Polarare Oberfläche (TPSA) | 26 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 1 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 13 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 155 |
|---|
| Schmelzpunkt | 212-213 °C (decomp) |
|---|
| Siedepunkt | 170-173 °C(Press: 16 Torr) |
|---|
| Dichte | 1.069±0.06 g/cm3(Predicted) |
|---|
| Lagerbedingungen | 2-8°C, protect from light |
|---|
| pKa (Säurekonstante) | 9.78±0.10(Predicted) |
|---|
| InChI | InChI=1S/C12H13N/c13-9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7H,8-9,13H2 |
|---|
| InChIKey | RUJHATQMIMUYKD-UHFFFAOYSA-N |
|---|
| SMILES | C1(CCN)=C2C(C=CC=C2)=CC=C1 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302+H312+H332 (33.3%): Harmful if swallowed, in contact with skin or if inhaled [Warning Acute toxicity, oralacute toxicity, dermalacute toxicity, inhalation]P260, P261, P264, P264+P265, P270, P271, P280, P301+P317, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P351+P338, P305+P354+P338, P316, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (66.7%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
