HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Naphthalin-1-methanol
NaphthaleneMethanol · 1-menaphthylalcohol · FC7H · 1-NaphthaL · enemethanoL · 1-Naphtylmethanol · 1-Naphthylmethanol · 1-Naphthylcarbinol
Identifikatoren & physikalische Daten
| CAS No. | 4780-79-4 |
|---|---|
| Summenformel | C11H10O |
| Durchschnittliche Molmasse | 158,2 g/mol |
| Monoisotopische Masse | 158,07316494 g/mol |
| SMILES | OCc1cccc2ccccc12 |
| InChIKey | PBLNHHSDYFYZNC-UHFFFAOYSA-N |
| PubChem CID | 20908 |
| ChEMBL | CHEMBL1288 |
| ChEBI | CHEBI:38137 |
| EC No. | 225-324-1 |
| DTXSID | DTXSID30197295 |
| Lokaler Name | Naphthalin-1-methanol |
Chemische & physikalische Eigenschaften
| XLogP | 2,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 20,2 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 144 |
| Arzneimittel | Pharmaceuticals -> Metabolite of Terbinafine |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| Pestizide | Environmental transformation -> Pesticide transformation products (metabolite, successor) |
| LogP (Verteilungskoeffizient) | 2.37 |
| Schmelzpunkt | 61-63 °C (lit.) |
| Siedepunkt | 301 °C/715 mmHg (lit.) |
| Dichte | 1.1039 |
| Brechungsindex | 1.5440 (estimate) |
| Flammpunkt | 301°C/715mm |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | soluble in Methanol |
| pKa (Säurekonstante) | 14.22±0.10(Predicted) |
| Aggregatzustand | Fine Crystalline Powder |
| Farbe | Yellow |
| BRN | 2042532 |
| InChI | InChI=1S/C11H10O/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7,12H,8H2 |
| InChIKey | PBLNHHSDYFYZNC-UHFFFAOYSA-N |
| SMILES | C1(CO)=C2C(C=CC=C2)=CC=C1 |
| CAS Datenbank | 4780-79-4(CAS DataBase Reference) |
| NIST chemische Informationen | 1-Naphthalenemethanol(4780-79-4) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Regulatorische Informationen | 1-Naphthalenemethanol: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| Wassergefährdungsklasse (WGK) | 2 |
| Zollcode | 29062990 |
| RTECS-Nr. | QJ8880000 |
| Sicherheitshinweise (S) | 24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
1-Naphthalenemethanol was used to investigate UV photooxidation of 1-methylnaphthalene in the presence of dry or humid air.